|
CAS#: 40716-80-1 Product: 1H-Indole-3-propanol Phosphate No suppilers available for the product. |
| Name | 1H-Indole-3-propanol Phosphate |
|---|---|
| Synonyms | Indole-3-Propanol Phosphate; 1-(Indol-3-Yl)Propanol 3-Phosphate; C04229 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14NO4P |
| Molecular Weight | 255.21 |
| CAS Registry Number | 40716-80-1 |
| SMILES | C2=C(CCCO[P](=O)(O)O)C1=C(C=CC=C1)[NH]2 |
| InChI | 1S/C11H14NO4P/c13-17(14,15)16-7-3-4-9-8-12-11-6-2-1-5-10(9)11/h1-2,5-6,8,12H,3-4,7H2,(H2,13,14,15) |
| InChIKey | NKEZSFZOUIIZFL-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.638°C at 760 mmHg (Cal.) |
| Flash point | 273.511°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indole-3-propanol Phosphate |