|
CAS#: 4074-74-2 Product: N,N-Dimethyl-2-Benzothiazolamine No suppilers available for the product. |
| Name | N,N-Dimethyl-2-Benzothiazolamine |
|---|---|
| Synonyms | 1,3-Benzothiazol-2-Yl-Dimethyl-Amine; Inchi=1/C9h10n2s/C1-11(2)9-10-7-5-3-4-6-8(7)12-9/H3-6H,1-2H; 2-Benzothiazolamine, N,N-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.25 |
| CAS Registry Number | 4074-74-2 |
| SMILES | C1=CC=CC2=C1SC(=N2)N(C)C |
| InChI | 1S/C9H10N2S/c1-11(2)9-10-7-5-3-4-6-8(7)12-9/h3-6H,1-2H3 |
| InChIKey | RIHDPQKLSOXBOH-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.825°C at 760 mmHg (Cal.) |
| Flash point | 114.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-2-Benzothiazolamine |