|
CAS#: 407610-69-9 Product: 2-Amino-6-(4-Chlorophenyl)-4(1H)-Pteridinone No suppilers available for the product. |
| Name | 2-Amino-6-(4-Chlorophenyl)-4(1H)-Pteridinone |
|---|---|
| Synonyms | 2-Amino-6-(4-chlorophenyl)-4(1H)-pteridinone; 2-Amino-6-(4-chlorophényl)-4(1H)-ptéridinone; 2-Amino-6-(4-chlorphenyl)-4(1H)-pteridinon |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClN5O |
| Molecular Weight | 273.68 |
| CAS Registry Number | 407610-69-9 |
| SMILES | c1cc(ccc1c2cnc3c(n2)c(=O)nc([nH]3)N)Cl |
| InChI | 1S/C12H8ClN5O/c13-7-3-1-6(2-4-7)8-5-15-10-9(16-8)11(19)18-12(14)17-10/h1-5H,(H3,14,15,17,18,19) |
| InChIKey | CHZRFQHJFLJXTB-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.6±60.0°C at 760 mmHg (Cal.) |
| Flash point | 281.4±32.9°C (Cal.) |
| Refractive index | 1.805 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-(4-Chlorophenyl)-4(1H)-Pteridinone |