|
CAS#: 40790-02-1 Product: 4-Mercapto-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Butan-2-One No suppilers available for the product. |
| Name | 4-Mercapto-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Butan-2-One |
|---|---|
| Synonyms | 4-Mercapto-4-(2,6,6-Trimethyl-1-Cyclohexenyl)Butan-2-One; 4-Mercapto-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Butan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22OS |
| Molecular Weight | 226.38 |
| CAS Registry Number | 40790-02-1 |
| EINECS | 255-083-8 |
| SMILES | C(C(S)C1=C(CCCC1(C)C)C)C(=O)C |
| InChI | 1S/C13H22OS/c1-9-6-5-7-13(3,4)12(9)11(15)8-10(2)14/h11,15H,5-8H2,1-4H3 |
| InChIKey | DOQZSHAHBHVWFG-UHFFFAOYSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.837°C at 760 mmHg (Cal.) |
| Flash point | 133.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Mercapto-4-(2,6,6-Trimethyl-1-Cyclohexen-1-Yl)Butan-2-One |