|
CAS#: 40801-43-2 Product: Methyl 6-(2-Hydroxyphenyl)-4,6-Dimethyl-5-Oxo-1,3-Cyclohexadiene-1-Carboxylate No suppilers available for the product. |
| Name | Methyl 6-(2-Hydroxyphenyl)-4,6-Dimethyl-5-Oxo-1,3-Cyclohexadiene-1-Carboxylate |
|---|---|
| Synonyms | Methyl 6- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 40801-43-2 |
| SMILES | O=C2/C(=C\C=C(\C(=O)OC)C2(c1ccccc1O)C)C |
| InChI | 1S/C16H16O4/c1-10-8-9-12(15(19)20-3)16(2,14(10)18)11-6-4-5-7-13(11)17/h4-9,17H,1-3H3 |
| InChIKey | TYMSLJGRPUNYIN-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.591°C at 760 mmHg (Cal.) |
| Flash point | 153.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 6-(2-Hydroxyphenyl)-4,6-Dimethyl-5-Oxo-1,3-Cyclohexadiene-1-Carboxylate |