|
CAS#: 40834-96-6 Product: (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(E,3S)-3-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid No suppilers available for the product. |
| Name | (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(E,3S)-3-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| Synonyms | Pdsp2_000737; 15-Methoxyprostaglandin F2alpha; O-15-Methylprostaglandin F2alpha Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 |
| CAS Registry Number | 40834-96-6 |
| SMILES | [C@H]1([C@H]([C@@H](O)C[C@H]1O)C\C=C/CCCC(=O)O)\C=C\[C@@H](OC)CCCCC |
| InChI | 1S/C21H36O5/c1-3-4-7-10-16(26-2)13-14-18-17(19(22)15-20(18)23)11-8-5-6-9-12-21(24)25/h5,8,13-14,16-20,22-23H,3-4,6-7,9-12,15H2,1-2H3,(H,24,25)/b8-5-,14-13+/t16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | RGZAEYWCXILWFX-NVRZHKMMSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.244°C at 760 mmHg (Cal.) |
| Flash point | 169.863°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(E,3S)-3-methoxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |