|
CAS#: 40845-26-9 Product: 2-Chloro-7-Hydroxy-10H-Phenothiazine-10-Propanoic Acid No suppilers available for the product. |
| Name | 2-Chloro-7-Hydroxy-10H-Phenothiazine-10-Propanoic Acid |
|---|---|
| Synonyms | 3-(2-Chloro-7-Hydroxy-Phenothiazin-10-Yl)Propanoic Acid; 3-(2-Chloro-7-Hydroxy-10-Phenothiazinyl)Propanoic Acid; 3-(2-Chloro-7-Hydroxy-Phenothiazin-10-Yl)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12ClNO3S |
| Molecular Weight | 321.78 |
| CAS Registry Number | 40845-26-9 |
| SMILES | C1=C3C(=CC=C1Cl)SC2=C(C=CC(=C2)O)N3CCC(=O)O |
| InChI | 1S/C15H12ClNO3S/c16-9-1-4-13-12(7-9)17(6-5-15(19)20)11-3-2-10(18)8-14(11)21-13/h1-4,7-8,18H,5-6H2,(H,19,20) |
| InChIKey | WBNPMYJLGASBPI-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.591°C at 760 mmHg (Cal.) |
| Flash point | 317.026°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-7-Hydroxy-10H-Phenothiazine-10-Propanoic Acid |