Online Database of Chemicals from Around the World
|
CAS#: 40870-69-7 Product: 2,3-Dimethyl-5-Acetoxymethyl-p-Benzoquinone No suppilers available for the product. |
| Name | 2,3-Dimethyl-5-Acetoxymethyl-p-Benzoquinone |
|---|---|
| Synonyms | Acetic Acid (4,5-Dimethyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)Methyl Ester; Acetic Acid (3,6-Diketo-4,5-Dimethyl-1-Cyclohexa-1,4-Dienyl)Methyl Ester; (4,5-Dimethyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)Methyl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 40870-69-7 |
| SMILES | C(OC(=O)C)C1=CC(=O)C(=C(C1=O)C)C |
| InChI | 1S/C11H12O4/c1-6-7(2)11(14)9(4-10(6)13)5-15-8(3)12/h4H,5H2,1-3H3 |
| InChIKey | ZIJFBURUJALJSL-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.201°C at 760 mmHg (Cal.) |
| Flash point | 128.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-5-Acetoxymethyl-p-Benzoquinone |