| 
CAS#: 40911-36-2 Product: Dichloromethyl O,O-Diphenyl Phosphonate No suppilers available for the product.  | 
| Name | Dichloromethyl O,O-Diphenyl Phosphonate | 
|---|---|
| Synonyms | Dichloromethyl O,O-Diphenyl Phosphonate; O,O-Diphenyl Dichloromethylphosphonate; (Dichloromethyl)Phosphonic Acid, Diphenyl | 
| Molecular Structure | ![]()  | 
| Molecular Formula | C13H11Cl2O3P | 
| Molecular Weight | 317.11 | 
| CAS Registry Number | 40911-36-2 | 
| SMILES | C1=CC=CC=C1O[P](=O)(C(Cl)Cl)OC2=CC=CC=C2 | 
| InChI | 1S/C13H11Cl2O3P/c14-13(15)19(16,17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10,13H | 
| InChIKey | JYVKVDGSFLTXME-UHFFFAOYSA-N | 
| Density | 1.384g/cm3 (Cal.) | 
|---|---|
| Boiling point | 382.726°C at 760 mmHg (Cal.) | 
| Flash point | 281.091°C (Cal.) | 
| Market Analysis Reports | 
| List of Reports Available for Dichloromethyl O,O-Diphenyl Phosphonate |