|
CAS#: 40931-15-5 Product: Ethyl 2,5-Dihydroxycinnamate No suppilers available for the product. |
| Name | Ethyl 2,5-Dihydroxycinnamate |
|---|---|
| Synonyms | (E)-3-(2,5-Dihydroxyphenyl)Prop-2-Enoic Acid Ethyl Ester; (E)-3-(2,5-Dihydroxyphenyl)Acrylic Acid Ethyl Ester; 2,5-Mec |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 40931-15-5 |
| SMILES | C1=C(C(=CC=C1O)O)\C=C\C(OCC)=O |
| InChI | 1S/C11H12O4/c1-2-15-11(14)6-3-8-7-9(12)4-5-10(8)13/h3-7,12-13H,2H2,1H3/b6-3+ |
| InChIKey | VNBYFUWBOIEPCR-ZZXKWVIFSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.253°C at 760 mmHg (Cal.) |
| Flash point | 162.039°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,5-Dihydroxycinnamate |