|
CAS#: 40951-13-1 Product: 16,17-Dihydro-11-Methyl-15H-Cyclopenta[a]Phenanthren-17-Ol No suppilers available for the product. |
| Name | 16,17-Dihydro-11-Methyl-15H-Cyclopenta[a]Phenanthren-17-Ol |
|---|---|
| Synonyms | 15,16-Dihydro-11-Methyl-17H-Cyclopenta(A)Phenanthren-17-Ol; 17H-Cyclopenta(A)Phenanthren-17-Ol, 15,16-Dihydro-11-Methyl |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 |
| CAS Registry Number | 40951-13-1 |
| SMILES | C1=C2C(=CC=C1)C=CC3=C2C(=CC4=C3CCC4O)C |
| InChI | 1S/C18H16O/c1-11-10-16-14(8-9-17(16)19)15-7-6-12-4-2-3-5-13(12)18(11)15/h2-7,10,17,19H,8-9H2,1H3 |
| InChIKey | CMGSCNRFRLIEPI-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.181°C at 760 mmHg (Cal.) |
| Flash point | 175.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16,17-Dihydro-11-Methyl-15H-Cyclopenta[a]Phenanthren-17-Ol |