|
CAS#: 40992-04-9 Product: 3-Chloro-1-(2-Hydroxy-3-Methoxy-6-Methylphenyl)-1-Propanone No suppilers available for the product. |
| Name | 3-Chloro-1-(2-Hydroxy-3-Methoxy-6-Methylphenyl)-1-Propanone |
|---|---|
| Synonyms | 3-Chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 |
| CAS Registry Number | 40992-04-9 |
| SMILES | ClCCC(=O)c1c(ccc(OC)c1O)C |
| InChI | 1S/C11H13ClO3/c1-7-3-4-9(15-2)11(14)10(7)8(13)5-6-12/h3-4,14H,5-6H2,1-2H3 |
| InChIKey | GCKPTYDLHGACHC-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.126°C at 760 mmHg (Cal.) |
| Flash point | 158.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-1-(2-Hydroxy-3-Methoxy-6-Methylphenyl)-1-Propanone |