|
CAS#: 4104-12-5 Product: N,N'-(3,3'-Dimethoxy[1,1'-Biphenyl]-4,4'-Diyl)Bis[3-Oxobutyramide] No suppilers available for the product. |
| Name | N,N'-(3,3'-Dimethoxy[1,1'-Biphenyl]-4,4'-Diyl)Bis[3-Oxobutyramide] |
|---|---|
| Synonyms | N-[2-Methoxy-4-[3-Methoxy-4-(3-Oxobutanoylamino)Phenyl]Phenyl]-3-Oxo-Butanamide; N-[4-[4-(1,3-Dioxobutylamino)-3-Methoxyphenyl]-2-Methoxyphenyl]-3-Oxobutanamide; N-[4-[4-(Acetoacetylamino)-3-Methoxy-Phenyl]-2-Methoxy-Phenyl]-3-Keto-Butyramide |
| Molecular Structure | ![]() |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 |
| CAS Registry Number | 4104-12-5 |
| EINECS | 223-873-1 |
| SMILES | C2=C(C1=CC(=C(NC(CC(C)=O)=O)C=C1)OC)C=CC(=C2OC)NC(CC(C)=O)=O |
| InChI | 1S/C22H24N2O6/c1-13(25)9-21(27)23-17-7-5-15(11-19(17)29-3)16-6-8-18(20(12-16)30-4)24-22(28)10-14(2)26/h5-8,11-12H,9-10H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | QCGJBSHPJVTZSR-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 632.948°C at 760 mmHg (Cal.) |
| Flash point | 336.595°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N'-(3,3'-Dimethoxy[1,1'-Biphenyl]-4,4'-Diyl)Bis[3-Oxobutyramide] |