|
CAS#: 41080-91-5 Product: 1,3,5-Tris(2,2-Dimethylpropyl)-2-Iodo-4-Methylbenzene No suppilers available for the product. |
| Name | 1,3,5-Tris(2,2-Dimethylpropyl)-2-Iodo-4-Methylbenzene |
|---|---|
| Synonyms | 2-Iodo-4-methyl-1,3,5-trineopentylbenzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C22H37I |
| Molecular Weight | 428.43 |
| CAS Registry Number | 41080-91-5 |
| SMILES | Ic1c(c(c(cc1CC(C)(C)C)CC(C)(C)C)C)CC(C)(C)C |
| InChI | 1S/C22H37I/c1-15-16(12-20(2,3)4)11-17(13-21(5,6)7)19(23)18(15)14-22(8,9)10/h11H,12-14H2,1-10H3 |
| InChIKey | USTXXEHEEGDJAG-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.692°C at 760 mmHg (Cal.) |
| Flash point | 188.271°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tris(2,2-Dimethylpropyl)-2-Iodo-4-Methylbenzene |