|
CAS#: 41115-69-9 Product: 5,6-Dibromo-1H-Indole-3-Ethanamine No suppilers available for the product. |
| Name | 5,6-Dibromo-1H-Indole-3-Ethanamine |
|---|---|
| Synonyms | 2-(5,6-Dibromo-1H-Indol-3-Yl)Ethylamine; Indole, 3-(2-Aminoethyl) 5,6-Dibromo-; Nsc211396 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Br2N2 |
| Molecular Weight | 318.01 |
| CAS Registry Number | 41115-69-9 |
| SMILES | C1=C(C(=CC2=C1C(=C[NH]2)CCN)Br)Br |
| InChI | 1S/C10H10Br2N2/c11-8-3-7-6(1-2-13)5-14-10(7)4-9(8)12/h3-5,14H,1-2,13H2 |
| InChIKey | QCSXERFQDJZYFJ-UHFFFAOYSA-N |
| Density | 1.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.954°C at 760 mmHg (Cal.) |
| Flash point | 225.319°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dibromo-1H-Indole-3-Ethanamine |