|
CAS#: 41139-98-4 Product: 1,8-Dimethylfluoren-9-One No suppilers available for the product. |
| Name | 1,8-Dimethylfluoren-9-One |
|---|---|
| Synonyms | 1,8-Dimethyl-9-Fluorenone; 9H-Fluoren-9-One, 1,8-Dimethyl-; F-9-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 |
| CAS Registry Number | 41139-98-4 |
| SMILES | C1=CC=C(C2=C1C3=C(C2=O)C(=CC=C3)C)C |
| InChI | 1S/C15H12O/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15(16)13(9)11/h3-8H,1-2H3 |
| InChIKey | LJYATQRMZUCOSJ-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.313°C at 760 mmHg (Cal.) |
| Flash point | 168.449°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dimethylfluoren-9-One |