|
CAS#: 41194-86-9 Product: 4-Bromo-2-Methoxy-5-Methylphenyl 3-Chloropropanoate No suppilers available for the product. |
| Name | 4-Bromo-2-Methoxy-5-Methylphenyl 3-Chloropropanoate |
|---|---|
| Synonyms | 4-Bromo-2-methoxy-5-methylphenyl 3-chloropropanoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12BrClO3 |
| Molecular Weight | 307.57 |
| CAS Registry Number | 41194-86-9 |
| SMILES | Brc1cc(OC)c(OC(=O)CCCl)cc1C |
| InChI | 1S/C11H12BrClO3/c1-7-5-10(16-11(14)3-4-13)9(15-2)6-8(7)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | ATOOEDHYGQDCLO-UHFFFAOYSA-N |
| Density | 1.455g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.383°C at 760 mmHg (Cal.) |
| Flash point | 159.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2-Methoxy-5-Methylphenyl 3-Chloropropanoate |