|
CAS#: 4120-77-8 Product: N-Phenanthren-2-Ylacetamide No suppilers available for the product. |
| Name | N-Phenanthren-2-Ylacetamide |
|---|---|
| Synonyms | N-(2-Phenanthryl)Acetamide; N-Phenanthren-2-Ylethanamide; 2-Acetaminophenanthrene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28 |
| CAS Registry Number | 4120-77-8 |
| SMILES | C1=C(NC(=O)C)C=C2C(=C1)C3=C(C=C2)C=CC=C3 |
| InChI | 1S/C16H13NO/c1-11(18)17-14-8-9-16-13(10-14)7-6-12-4-2-3-5-15(12)16/h2-10H,1H3,(H,17,18) |
| InChIKey | NOEOUKDLTDMGKA-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.941°C at 760 mmHg (Cal.) |
| Flash point | 302.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenanthren-2-Ylacetamide |