|
CAS#: 41227-52-5 Product: 2-Isooctyl-4,6-Dinitrophenol No suppilers available for the product. |
| Name | 2-Isooctyl-4,6-Dinitrophenol |
|---|---|
| Synonyms | 2-(6-Methylheptyl)-4,6-Dinitro-Phenol; 2-Isooctyl-4,6-Dinitrophenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 |
| CAS Registry Number | 41227-52-5 |
| EINECS | 255-270-4 |
| SMILES | C1=C([N+]([O-])=O)C=C(C(=C1[N+]([O-])=O)O)CCCCCC(C)C |
| InChI | 1S/C14H20N2O5/c1-10(2)6-4-3-5-7-11-8-12(15(18)19)9-13(14(11)17)16(20)21/h8-10,17H,3-7H2,1-2H3 |
| InChIKey | VZPYZYHXSMGBJT-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.223°C at 760 mmHg (Cal.) |
| Flash point | 166.188°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isooctyl-4,6-Dinitrophenol |