|
CAS#: 4129-41-3 Product: (Phenylamino)Diphenylphosphine Sulfide No suppilers available for the product. |
| Name | (Phenylamino)Diphenylphosphine Sulfide |
|---|---|
| Synonyms | Di(Phenyl)Thiophosphoryl-Phenyl-Amine; N,P,P-Triphenylphosphinothioic Amide; Nsc59747 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16NPS |
| Molecular Weight | 309.36 |
| CAS Registry Number | 4129-41-3 |
| SMILES | C1=CC=CC=C1[P](C2=CC=CC=C2)(NC3=CC=CC=C3)=S |
| InChI | 1S/C18H16NPS/c21-20(17-12-6-2-7-13-17,18-14-8-3-9-15-18)19-16-10-4-1-5-11-16/h1-15H,(H,19,21) |
| InChIKey | GPVKWTVVLUPNCD-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.428°C at 760 mmHg (Cal.) |
| Flash point | 222.582°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Phenylamino)Diphenylphosphine Sulfide |