Online Database of Chemicals from Around the World
|
CAS#: 41333-51-1 Product: 2,5-Dimethoxy-4-[(4-Methylphenyl)Sulfanyl]Benzenediazonium Hexafluorophosphate No suppilers available for the product. |
| Name | 2,5-Dimethoxy-4-[(4-Methylphenyl)Sulfanyl]Benzenediazonium Hexafluorophosphate |
|---|---|
| Synonyms | 2,5-dimet |
| Molecular Structure | ![CAS#: 41333-51-1, 2,5-Dimethoxy-4-[(4-Methylphenyl)Sulfanyl]Benzenediazonium Hexafluorophosphate](/moreStructures/41333-51-1.gif) |
| Molecular Formula | C15H15F6N2O2PS |
| CAS Registry Number | 41333-51-1 |
| EINECS | 255-320-5 |
| SMILES | F[P-](F)(F)(F)(F)F.Cc1ccc(cc1)Sc2cc(OC)c(cc2OC)[N+]#N |
| InChI | 1S/C15H15N2O2S.F6P/c1-10-4-6-11(7-5-10)20-15-9-13(18-2)12(17-16)8-14(15)19-3;1-7(2,3,4,5)6/h4-9H,1-3H3;/q+1;-1 |
| InChIKey | BQESUXZHHVVEGH-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethoxy-4-[(4-Methylphenyl)Sulfanyl]Benzenediazonium Hexafluorophosphate |