|
CAS#: 41405-77-0 Product: 3-Carboxyantipyrine No suppilers available for the product. |
| Name | 3-Carboxyantipyrine |
|---|---|
| Synonyms | 2-Methyl-5-Oxo-1-Phenyl-Pyrazole-3-Carboxylic Acid; 2-Methyl-5-Oxo-1-Phenyl-3-Pyrazolecarboxylic Acid; 5-Keto-2-Methyl-1-Phenyl-Pyrazole-3-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 41405-77-0 |
| SMILES | C2=C(N1N(C(=CC1=O)C(=O)O)C)C=CC=C2 |
| InChI | 1S/C11H10N2O3/c1-12-9(11(15)16)7-10(14)13(12)8-5-3-2-4-6-8/h2-7H,1H3,(H,15,16) |
| InChIKey | OIHMJESJURQMDG-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.691°C at 760 mmHg (Cal.) |
| Flash point | 168.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Carboxyantipyrine |