|
CAS#: 4147-10-8 Product: 3-Methoxy-1,3,5(10)-Gonatrien-17-One No suppilers available for the product. |
| Name | 3-Methoxy-1,3,5(10)-Gonatrien-17-One |
|---|---|
| Synonyms | 18,19-Dinorandrosta-1,3,5(10)-Trien-17-One, 3-Methoxy-; 3-Methoxygona-1,3,5(10)-Trien-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 4147-10-8 |
| SMILES | [C@@H]13CCC(=O)C1CC[C@@H]4C2=C(C=C(C=C2)OC)CC[C@@H]34 |
| InChI | 1S/C18H22O2/c1-20-12-3-5-13-11(10-12)2-4-15-14(13)6-7-17-16(15)8-9-18(17)19/h3,5,10,14-17H,2,4,6-9H2,1H3/t14-,15-,16+,17?/m1/s1 |
| InChIKey | GDDDQTOBTQTTJD-VPSFDDGASA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.551°C at 760 mmHg (Cal.) |
| Flash point | 191.028°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-1,3,5(10)-Gonatrien-17-One |