|
CAS#: 4151-60-4 Product: 2-(1,1-Dimethylethyl)-5-(1-Methylethyl)Phenol No suppilers available for the product. |
| Name | 2-(1,1-Dimethylethyl)-5-(1-Methylethyl)Phenol |
|---|---|
| Synonyms | 2-Tert-Butyl-5-Isopropyl-Phenol; 2-Tert-Butyl-5-Isopropylphenol; 2-Tert-Butyl-5-Propan-2-Yl-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 4151-60-4 |
| SMILES | C1=C(C=CC(=C1O)C(C)(C)C)C(C)C |
| InChI | 1S/C13H20O/c1-9(2)10-6-7-11(12(14)8-10)13(3,4)5/h6-9,14H,1-5H3 |
| InChIKey | DBULNVCXEGKRIX-UHFFFAOYSA-N |
| Density | 0.94g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.765°C at 760 mmHg (Cal.) |
| Flash point | 125.579°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,1-Dimethylethyl)-5-(1-Methylethyl)Phenol |