Online Database of Chemicals from Around the World
|
CAS#: 41530-82-9 Product: (1'R,2R,2'R,7'S,9'S)-3',3',7'-Trimethylspiro[Oxirane-2,8'-Tricyclo[5.4.0.02,9]Undecane] No suppilers available for the product. |
| Name | (1'R,2R,2'R,7'S,9'S)-3',3',7'-Trimethylspiro[Oxirane-2,8'-Tricyclo[5.4.0.02,9]Undecane] |
|---|---|
| Synonyms | Longifolene epoxide; Spiro(1,4 |
| Molecular Structure | ![CAS#: 41530-82-9, (1'R,2R,2'R,7'S,9'S)-3',3',7'-Trimethylspiro[Oxirane-2,8'-Tricyclo[5.4.0.0<Sup>2,9</Sup>]Undecane]](/moreStructures/41530-82-9.gif) |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 41530-82-9 |
| SMILES | O4[C@]2([C@@]1([C@H]3[C@@H](C(CCC1)(C)C)[C@@H]2CC3)C)C4 |
| InChI | 1S/C15H24O/c1-13(2)7-4-8-14(3)10-5-6-11(12(10)13)15(14)9-16-15/h10-12H,4-9H2,1-3H3/t10-,11+,12-,14+,15-/m1/s1 |
| InChIKey | JGOMSUGOZLJMRV-FMKNKJFCSA-N |
| Density | 1.048g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.375°C at 760 mmHg (Cal.) |
| Flash point | 98.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1'R,2R,2'R,7'S,9'S)-3',3',7'-Trimethylspiro[Oxirane-2,8'-Tricyclo[5.4.0.02,9]Undecane] |