|
CAS#: 41593-38-8 Product: Propylene glycol phenyl ether No suppilers available for the product. |
| Name | Propylene glycol phenyl ether |
|---|---|
| Synonyms | Propanol, Phenoxy-; Propylene Glycol Phenyl Ether; 1(Or 2)-Phenoxypropanol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 |
| CAS Registry Number | 41593-38-8 |
| SMILES | C2=C(OC1=CC=CC=C1)C=CC=C2.C(O)C(O)C |
| InChI | 1S/C12H10O.C3H8O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(5)2-4/h1-10H;3-5H,2H2,1H3 |
| InChIKey | MGWPJPVJIYDXGB-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Propylene glycol phenyl ether |