|
CAS#: 41623-27-2 Product: Estrone 3-(4-Nitrobenzoate) No suppilers available for the product. |
| Name | Estrone 3-(4-Nitrobenzoate) |
|---|---|
| Synonyms | 4-Nitrobenzoic Acid (13-Methyl-17-Oxo-7,8,9,11,12,14,15,16-Octahydro-6H-Cyclopenta[A]Phenanthren-3-Yl) Ester; 4-Nitrobenzoic Acid (17-Keto-13-Methyl-7,8,9,11,12,14,15,16-Octahydro-6H-Cyclopenta[A]Phenanthren-3-Yl) Ester; Estra-1,3,5(10)-Trien-17-One, 3-[(4-Nitrobenzoyl)Oxy]- |
| Molecular Structure | ![]() |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 |
| CAS Registry Number | 41623-27-2 |
| SMILES | C1=CC(=CC4=C1C2C(C3C(CC2)(C(CC3)=O)C)CC4)OC(C5=CC=C(C=C5)[N+](=O)[O-])=O |
| InChI | 1S/C25H25NO5/c1-25-13-12-20-19-9-7-18(31-24(28)15-2-5-17(6-3-15)26(29)30)14-16(19)4-8-21(20)22(25)10-11-23(25)27/h2-3,5-7,9,14,20-22H,4,8,10-13H2,1H3 |
| InChIKey | HSVAEISJKGHUGC-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.618°C at 760 mmHg (Cal.) |
| Flash point | 234.234°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estrone 3-(4-Nitrobenzoate) |