|
CAS#: 41658-76-8 Product: Magnesium Bisgalacturonate No suppilers available for the product. |
| Name | Magnesium Bisgalacturonate |
|---|---|
| Synonyms | Magnesium (2S,3R,4S,5R)-2,3,4,5-Tetrahydroxy-6-Oxo-Hexanoate; Magnesium (2S,3R,4S,5R)-2,3,4,5-Tetrahydroxy-6-Keto-Hexanoate; Magnesium Bisgalacturonate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18MgO14 |
| Molecular Weight | 410.57 |
| CAS Registry Number | 41658-76-8 |
| EINECS | 255-480-6 |
| SMILES | [C@@H](O)([C@H](O)[C@@H](O)C=O)[C@H](O)C([O-])=O.[C@@H](O)([C@H](O)[C@@H](O)C=O)[C@H](O)C([O-])=O.[Mg++] |
| InChI | 1S/2C6H10O7.Mg/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*1-5,8-11H,(H,12,13);/q;;+2/p-2/t2*2-,3+,4+,5-;/m00./s1 |
| InChIKey | IGOLIOYHVTUECC-PDCYBDDKSA-L |
| Boiling point | 553.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 302.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Magnesium Bisgalacturonate |