| Name | Anthracene-1,5-Dicarboxylic Acid |
|---|---|
| Synonyms | 1,5-Anthracenedicarboxylic Acid; A-1,5-Dca |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 |
| CAS Registry Number | 41694-83-1 |
| SMILES | C3=CC=C2C=C1C(=CC=CC1=CC2=C3C(=O)O)C(=O)O |
| InChI | 1S/C16H10O4/c17-15(18)11-5-1-3-9-7-14-10(8-13(9)11)4-2-6-12(14)16(19)20/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | WYNLDQIVFWSFIN-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.116°C at 760 mmHg (Cal.) |
| Flash point | 327.746°C (Cal.) |
| (1) | Jun-Jie Wang, Tong-Liang Hu and Xian-He Bu. Cadmium(ii) and zinc(ii) metal–organic frameworks with anthracene-based dicarboxylic ligands: solvothermal synthesis, crystal structures, and luminescent properties, CrystEngComm, 2011, 13, 5152. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Anthracene-1,5-Dicarboxylic Acid |