|
CAS#: 41696-74-6 Product: 5-(1-Ethoxyethoxy)-N,N-Dimethylbicyclo[2.2.1]Hept-2-En-2-Amine No suppilers available for the product. |
| Name | 5-(1-Ethoxyethoxy)-N,N-Dimethylbicyclo[2.2.1]Hept-2-En-2-Amine |
|---|---|
| Synonyms | N-[5-(1-E |
| Molecular Structure | ![]() |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 |
| CAS Registry Number | 41696-74-6 |
| SMILES | O(C(OCC)C)C2C1/C=C(/N(C)C)C(C1)C2 |
| InChI | 1S/C13H23NO2/c1-5-15-9(2)16-13-8-10-6-11(13)7-12(10)14(3)4/h7,9-11,13H,5-6,8H2,1-4H3 |
| InChIKey | ZLNXXORAQOJWRU-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.167°C at 760 mmHg (Cal.) |
| Flash point | 90.251°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Ethoxyethoxy)-N,N-Dimethylbicyclo[2.2.1]Hept-2-En-2-Amine |