|
CAS#: 41743-86-6 Product: Sativan No suppilers available for the product. |
| Name | Sativan |
|---|---|
| Synonyms | (3R)-3-(2,4-Dimethoxyphenyl)-7-Chromanol; C10526; 2H-1-Benzopyran-7-Ol, 3-(2,4-Dimethoxyphenyl)-3,4-Dihydro-, (3R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 |
| CAS Registry Number | 41743-86-6 |
| SMILES | [C@H]2(C1=CC=C(OC)C=C1OC)CC3=C(OC2)C=C(O)C=C3 |
| InChI | 1S/C17H18O4/c1-19-14-5-6-15(17(9-14)20-2)12-7-11-3-4-13(18)8-16(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | TUXCLJQCYVCGDW-LBPRGKRZSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.57°C at 760 mmHg (Cal.) |
| Flash point | 222.064°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sativan |