|
CAS#: 4177-42-8 Product: 2,2,4,6-Tetramethyl-1-(Propionyl)Piperazine No suppilers available for the product. |
| Name | 2,2,4,6-Tetramethyl-1-(Propionyl)Piperazine |
|---|---|
| Synonyms | 1-(2,2,4,6-Tetramethyl-1-Piperazinyl)Propan-1-One; 1-Propionyl-2,2,4,6-Tetramethyl Piperazine; 2,2,4,6-Tetramethyl-1-Propionyl Piperazine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 |
| CAS Registry Number | 4177-42-8 |
| SMILES | C(C(N1C(CN(CC1C)C)(C)C)=O)C |
| InChI | 1S/C11H22N2O/c1-6-10(14)13-9(2)7-12(5)8-11(13,3)4/h9H,6-8H2,1-5H3 |
| InChIKey | UBGGREWUFINDKK-UHFFFAOYSA-N |
| Density | 0.924g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.058°C at 760 mmHg (Cal.) |
| Flash point | 104.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4,6-Tetramethyl-1-(Propionyl)Piperazine |