|
CAS#: 41841-01-4 Product: 2-Chloro-4''-Methoxybenzil No suppilers available for the product. |
| Name | 2-Chloro-4''-Methoxybenzil |
|---|---|
| Synonyms | Nsc174117 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 |
| CAS Registry Number | 41841-01-4 |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=C(Cl)C=CC=C2)OC |
| InChI | 1S/C15H11ClO3/c1-19-11-8-6-10(7-9-11)14(17)15(18)12-4-2-3-5-13(12)16/h2-9H,1H3 |
| InChIKey | XQQVCLAFSXCQJR-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.789°C at 760 mmHg (Cal.) |
| Flash point | 180.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4''-Methoxybenzil |