|
CAS#: 41863-30-3 Product: Sodium DL-Methionate No suppilers available for the product. |
| Name | Sodium DL-Methionate |
|---|---|
| Synonyms | Sodium 2-Amino-4-Methylsulfanyl-Butanoate; Sodium 2-Amino-4-(Methylthio)Butanoate; Sodium 2-Amino-4-(Methylthio)Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10NNaO2S |
| Molecular Weight | 171.19 |
| CAS Registry Number | 41863-30-3 |
| EINECS | 255-568-4 |
| SMILES | C(C(N)C([O-])=O)CSC.[Na+] |
| InChI | 1S/C5H11NO2S.Na/c1-9-3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8);/q;+1/p-1 |
| InChIKey | IREPZTZSVPKCAR-UHFFFAOYSA-M |
| Boiling point | 306.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium DL-Methionate |