| Name | 2-Hydroxyphenazine |
|---|---|
| Synonyms | Aids-019756; Aids019756; Zinc03843484 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 |
| CAS Registry Number | 4190-95-8 |
| SMILES | C3=C2NC1=CC(=O)C=CC1=NC2=CC=C3 |
| InChI | 1S/C12H8N2O/c15-8-5-6-11-12(7-8)14-10-4-2-1-3-9(10)13-11/h1-7,14H |
| InChIKey | AZHUGLQVXUMICS-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.254°C at 760 mmHg (Cal.) |
| Flash point | 162.604°C (Cal.) |
| (1) | Zhang-Gui Ding, Ming-Gang Li, Jie Ren, Jiang-Yuan Zhao, Rong Huang, Qing-Zhong Wang, Xiao-Long Cui, Hua-Jie Zhu and Meng-Liang Wen. Phenazinolins A–E: novel diphenazines from a tin mine tailings-derived Streptomyces species, Org. Biomol. Chem., 2011, 9, 2771. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxyphenazine |