|
CAS#: 4196-98-9 Product: Ethylene Phthalate No suppilers available for the product. |
| Name | Ethylene Phthalate |
|---|---|
| Synonyms | 3,4-Dihydro-2,5-Benzodioxocine-1,6-Quinone; Ethylene Phthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 |
| CAS Registry Number | 4196-98-9 |
| EINECS | 224-082-4 |
| SMILES | C2=C1C(OCCOC(C1=CC=C2)=O)=O |
| InChI | 1S/C10H8O4/c11-9-7-3-1-2-4-8(7)10(12)14-6-5-13-9/h1-4H,5-6H2 |
| InChIKey | SENMPMXZMGNQAG-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.389°C at 760 mmHg (Cal.) |
| Flash point | 250.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylene Phthalate |