| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Endotherm GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (681) 3946-7570 | |||
![]() |
info@endotherm.de | |||
| Chemical manufacturer | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | (S)-1-(Isopropylamino)-3-(Naphthyloxy)Propan-2-Ol |
|---|---|
| Synonyms | (2S)-1-(Isopropylamino)-3-(1-Naphthyloxy)Propan-2-Ol; Prestwick0_001081; Kbio2_000380 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 |
| CAS Registry Number | 4199-09-1 |
| EINECS | 224-095-5 |
| SMILES | [C@H](COC1=C2C(=CC=C1)C=CC=C2)(O)CNC(C)C |
| InChI | 1S/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | AQHHHDLHHXJYJD-AWEZNQCLSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.857°C at 760 mmHg (Cal.) |
| Flash point | 216.794°C (Cal.) |
| (1) | Daniel Forchheimer, Gang Luo, Lars Montelius and Lei Ye. Molecularly imprinted nanostructures by nanoimprint lithography, Analyst, 2010, 135, 1219. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (S)-1-(Isopropylamino)-3-(Naphthyloxy)Propan-2-Ol |