|
CAS#: 4205-17-8 Product: 2-(4-Nitrophenyl)-4-Nitro-Imidazole No suppilers available for the product. |
| Name | 2-(4-Nitrophenyl)-4-Nitro-Imidazole |
|---|---|
| Synonyms | 2-(4-Nitrophenyl)-4-Nitro-1H-Imidazole (9Ci); Imidazole, 2-(4-Nitrophenyl)-4-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6N4O4 |
| Molecular Weight | 234.17 |
| CAS Registry Number | 4205-17-8 |
| SMILES | C2=C(C1=NC=C([NH]1)[N+]([O-])=O)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C9H6N4O4/c14-12(15)7-3-1-6(2-4-7)9-10-5-8(11-9)13(16)17/h1-5H,(H,10,11) |
| InChIKey | AKBWSCCZQFYAFH-UHFFFAOYSA-N |
| Density | 1.562g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.435°C at 760 mmHg (Cal.) |
| Flash point | 277.621°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Nitrophenyl)-4-Nitro-Imidazole |