| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Allantoin, compd. with p-aminobenzoic acid |
|---|---|
| Synonyms | 4-Aminobenzoic Acid; (2,5-Dioxo-4-Imidazolidinyl)Urea; 4-Aminobenzoic Acid; (2,5-Diketoimidazolidin-4-Yl)Urea; Allantoin Paba |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.25 |
| CAS Registry Number | 4207-42-5 |
| SMILES | O=C1NC(=O)NC1NC(=O)N.C2=C(C(O)=O)C=CC(=C2)N |
| InChI | 1S/C7H7NO2.C4H6N4O3/c8-6-3-1-5(2-4-6)7(9)10;5-3(10)6-1-2(9)8-4(11)7-1/h1-4H,8H2,(H,9,10);1H,(H3,5,6,10)(H2,7,8,9,11) |
| InChIKey | QWVSDCVMXDUGML-UHFFFAOYSA-N |
| Boiling point | 591.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 311.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allantoin, compd. with p-aminobenzoic acid |