|
CAS#: 4213-40-5 Product: 2-[[4-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Azo]Benzoic Acid No suppilers available for the product. |
| Name | 2-[[4-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Azo]Benzoic Acid |
|---|---|
| Synonyms | 2-[4-[Bis(2-Chloroethyl)Amino]-2-Methyl-Phenyl]Azobenzoic Acid; 2-[4-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Azobenzoic Acid; 2-[4-[Bis(2-Chloroethyl)Amino]-2-Methyl-Phenyl]Diazenylbenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.27 |
| CAS Registry Number | 4213-40-5 |
| SMILES | C1=C(N(CCCl)CCCl)C=C(C(=C1)N=NC2=C(C(=O)O)C=CC=C2)C |
| InChI | 1S/C18H19Cl2N3O2/c1-13-12-14(23(10-8-19)11-9-20)6-7-16(13)21-22-17-5-3-2-4-15(17)18(24)25/h2-7,12H,8-11H2,1H3,(H,24,25) |
| InChIKey | JRQFCUCILBFUNR-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 591.822°C at 760 mmHg (Cal.) |
| Flash point | 311.723°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[4-[Bis(2-Chloroethyl)Amino]-2-Methylphenyl]Azo]Benzoic Acid |