|
CAS#: 42138-72-7 Product: 2,3,4,5-Tetrachloro-6-Methoxyaniline No suppilers available for the product. |
| Name | 2,3,4,5-Tetrachloro-6-Methoxyaniline |
|---|---|
| Synonyms | 2,3,4,5-Tetrachloro-6-methoxyaniline # |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5Cl4NO |
| Molecular Weight | 260.93 |
| CAS Registry Number | 42138-72-7 |
| SMILES | Clc1c(c(OC)c(Cl)c(Cl)c1Cl)N |
| InChI | 1S/C7H5Cl4NO/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h12H2,1H3 |
| InChIKey | ONRFSTKRXHVKTI-UHFFFAOYSA-N |
| Density | 1.596g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.887°C at 760 mmHg (Cal.) |
| Flash point | 164.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5-Tetrachloro-6-Methoxyaniline |