Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4-Phenanthrenecarboxylic Acid) |
|---|---|
| Synonyms | 4-Phenanthrenecarboxylic Acid; Nsc141339 |
| Molecular Structure |  |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 42156-92-3 |
| SMILES | C1=CC=CC2=CC=C3C(=C12)C(=CC=C3)C(O)=O |
| InChI | 1S/C15H10O2/c16-15(17)13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h1-9H,(H,16,17) |
| InChIKey | HHZVGTSZLAQRSM-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.48°C at 760 mmHg (Cal.) |
| Flash point | 206.075°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Phenanthrenecarboxylic Acid) |