|
CAS#: 4220-32-0 Product: 2-(Dimethylamino)Ethyl Carbamate No suppilers available for the product. |
| Name | 2-(Dimethylamino)Ethyl Carbamate |
|---|---|
| Synonyms | 2-Carbamoyloxyethyl-Dimethyl-Ammonium Chloride; 2-Carbamoyloxyethyl-Dimethylammonium Chloride; 2-Aminocarbonyloxyethyl-Dimethyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C5H13ClN2O2 |
| Molecular Weight | 168.62 |
| CAS Registry Number | 4220-32-0 |
| EINECS | 224-163-4 |
| SMILES | C(OC(N)=O)C[NH+](C)C.[Cl-] |
| InChI | 1S/C5H12N2O2.ClH/c1-7(2)3-4-9-5(6)8;/h3-4H2,1-2H3,(H2,6,8);1H |
| InChIKey | POHVKKYDZVLISU-UHFFFAOYSA-N |
| Boiling point | 232.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 94.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)Ethyl Carbamate |