|
CAS#: 422318-46-5 Product: 7-Methyl-3,4-Dihydro-1H-1,4-Benzodiazepine-2,5-Dione No suppilers available for the product. |
| Name | 7-Methyl-3,4-Dihydro-1H-1,4-Benzodiazepine-2,5-Dione |
|---|---|
| Synonyms | 1H-1,4-BENZODIAZEPINE-2,5-DIONE,3,4-DIHYDRO-7-METHYL-; 7-Methyl-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 422318-46-5 |
| SMILES | O=C2Nc1c(cc(cc1)C)C(=O)NC2 |
| InChI | 1S/C10H10N2O2/c1-6-2-3-8-7(4-6)10(14)11-5-9(13)12-8/h2-4H,5H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | JJFCBBTZUGKHOX-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.774°C at 760 mmHg (Cal.) |
| Flash point | 255.13°C (Cal.) |
| Refractive index | 1.56 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methyl-3,4-Dihydro-1H-1,4-Benzodiazepine-2,5-Dione |