Online Database of Chemicals from Around the World
| Name | 4,7-Dichloro-2-(Trifluoromethyl)-1H-Benzimidazole |
|---|---|
| Synonyms | 4,7-Dichloro-2-(Trifluoromethyl)Benzimidazole; Benzimidazole, 4,7-Dichloro-2-(Trifluoromethyl)-; Brn 0960435 |
| Molecular Structure |  |
| Molecular Formula | C8H3Cl2F3N2 |
| Molecular Weight | 255.03 |
| CAS Registry Number | 4228-89-1 |
| SMILES | C2=C(C1=C([NH]C(=N1)C(F)(F)F)C(=C2)Cl)Cl |
| InChI | 1S/C8H3Cl2F3N2/c9-3-1-2-4(10)6-5(3)14-7(15-6)8(11,12)13/h1-2H,(H,14,15) |
| InChIKey | QECRKWYIIQPMPA-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.335°C at 760 mmHg (Cal.) |
| Flash point | 154.791°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dichloro-2-(Trifluoromethyl)-1H-Benzimidazole |
