|
CAS#: 42344-05-8 Product: N,N-Dimethyl-4-Nitrosoanilinium Chloride No suppilers available for the product. |
| Name | N,N-Dimethyl-4-Nitrosoanilinium Chloride |
|---|---|
| Synonyms | N,N-Dimethyl-4-Nitrosoaniline; Hydron; Chloride; N,N-Dimethyl-4-Nitroso-Aniline; Hydron; Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 |
| CAS Registry Number | 42344-05-8 |
| EINECS | 255-762-9 |
| SMILES | [H+].C1=C(C=CC(=C1)N(C)C)N=O.[Cl-] |
| InChI | 1S/C8H10N2O.ClH/c1-10(2)8-5-3-7(9-11)4-6-8;/h3-6H,1-2H3;1H |
| InChIKey | TVFXOIYPLHTRQR-UHFFFAOYSA-N |
| Boiling point | 258.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-Nitrosoanilinium Chloride |