|
CAS#: 4239-21-8 Product: 1,4-Butanedisulfonic acid, dimethyl ester No suppilers available for the product. |
| Name | 1,4-Butanedisulfonic acid, dimethyl ester |
|---|---|
| Synonyms | Butane-1,4-Disulfonic Acid O1,O4-Dimethyl Ester; 1,4-Butanedisulfonic Acid, Dimethyl Ester; Nsc25741 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14O6S2 |
| Molecular Weight | 246.29 |
| CAS Registry Number | 4239-21-8 |
| SMILES | C(CCC[S](OC)(=O)=O)[S](OC)(=O)=O |
| InChI | 1S/C6H14O6S2/c1-11-13(7,8)5-3-4-6-14(9,10)12-2/h3-6H2,1-2H3 |
| InChIKey | TTXMTFUPSPPMTK-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.701°C at 760 mmHg (Cal.) |
| Flash point | 228.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Butanedisulfonic acid, dimethyl ester |