|
CAS#: 42408-80-0 Product: Tandamine No suppilers available for the product. |
| Name | Tandamine |
|---|---|
| Synonyms | 2-(9-Ethyl-1-Methyl-3,4-Dihydrothiopyrano[3,4-B]Indol-1-Yl)-N,N-Dimethyl-Ethanamine Hydrochloride; 2-(9-Ethyl-1-Methyl-3,4-Dihydrothiopyrano[3,4-B]Indol-1-Yl)Ethyl-Dimethyl-Amine Hydrochloride; 9-Ethyl-1,3,4,9-Tetrahydro-N,N,1-Trimethylthiopyrano(3,4-B)Indole-1-Ethanamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H27ClN2S |
| Molecular Weight | 338.94 |
| CAS Registry Number | 42408-80-0 (58167-78-5) |
| SMILES | [H+].C2=C1C3=C([N](C1=CC=C2)CC)C(SCC3)(CCN(C)C)C.[Cl-] |
| InChI | 1S/C18H26N2S.ClH/c1-5-20-16-9-7-6-8-14(16)15-10-13-21-18(2,17(15)20)11-12-19(3)4;/h6-9H,5,10-13H2,1-4H3;1H |
| InChIKey | FJJSKKBQSGDHQK-UHFFFAOYSA-N |
| Boiling point | 441°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 220.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tandamine |