|
CAS#: 42434-88-8 Product: 2-(2-Bromophenoxy)-1-Phenylethan-1-One No suppilers available for the product. |
| Name | 2-(2-Bromophenoxy)-1-Phenylethan-1-One |
|---|---|
| Synonyms | 2-(2-Bromophenoxy)-1-Phenyl-Ethanone; 2-(2-Bromophenoxy)-1-Phenylethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11BrO2 |
| Molecular Weight | 291.14 |
| CAS Registry Number | 42434-88-8 |
| EINECS | 255-820-3 |
| SMILES | C1=CC=CC(=C1OCC(C2=CC=CC=C2)=O)Br |
| InChI | 1S/C14H11BrO2/c15-12-8-4-5-9-14(12)17-10-13(16)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | VMCDJFHHWCZFIK-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.191°C at 760 mmHg (Cal.) |
| Flash point | 199.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Bromophenoxy)-1-Phenylethan-1-One |