Online Database of Chemicals from Around the World
|
CAS#: 42445-51-2 Product: 2-Chloro-4-(2,4-Dichlorophenyl)-1,3-Thiazole No suppilers available for the product. |
| Name | 2-Chloro-4-(2,4-Dichlorophenyl)-1,3-Thiazole |
|---|---|
| Synonyms | 2-Chlor-4-(2,4-dichlorphenyl)-1,3-thiazol; 2-Chloro-4-(2,4-dichlorophenyl)-1,3-thiazole; 2-Chloro-4-(2,4-dichlorophényl)-1,3-thiazole |
| Molecular Structure |  |
| Molecular Formula | C9H4Cl3NS |
| Molecular Weight | 264.56 |
| CAS Registry Number | 42445-51-2 |
| SMILES | c1cc(c(cc1Cl)Cl)c2csc(n2)Cl |
| InChI | 1S/C9H4Cl3NS/c10-5-1-2-6(7(11)3-5)8-4-14-9(12)13-8/h1-4H |
| InChIKey | ZFVXUJBMOIPRJK-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.2±50.0°C at 760 mmHg (Cal.) |
| Flash point | 180.1±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-(2,4-Dichlorophenyl)-1,3-Thiazole |